C21H37N5OS — CID 111323200
N-[2-[[N-ethyl-N'-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide (PubChem CID 111323200) has the molecular formula C21H37N5OS and a molecular weight of 407.63 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111323200 |
| Molecular Formula | C21H37N5OS |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCC(C)CC1)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C21H37N5OS/c1-5-22-21(24-11-10-23-20(27)16(2)3)25-15-18(19-7-6-14-28-19)26-12-8-17(4)9-13-26/h6-7,14,16-18H,5,8-13,15H2,1-4H3,(H,23,27)(H2,22,24,25) |
| InChIKey | KBDWTVLTGZYBIQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|