C22H32IN5OS — CID 111011828
N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111011828) has the molecular formula C22H32IN5OS and a molecular weight of 541.50 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111011828 |
| Molecular Formula | C22H32IN5OS |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCCC1)NCCNC(=O)c1ccccc1.I |
| InChI | InChI=1S/C22H31N5OS.HI/c1-2-23-22(25-13-12-24-21(28)18-9-4-3-5-10-18)26-17-19(20-11-8-16-29-20)27-14-6-7-15-27;/h3-5,8-11,16,19H,2,6-7,12-15,17H2,1H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | XANNTMQCYYGQTG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|