C25H35N5O2 — CID 111322846
N-[2-[[N-ethyl-N'-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111322846) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111322846 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCC1)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H35N5O2/c1-3-26-25(28-16-15-27-24(31)20-11-5-4-6-12-20)29-19-22(30-17-9-10-18-30)21-13-7-8-14-23(21)32-2/h4-8,11-14,22H,3,9-10,15-19H2,1-2H3,(H,27,31)(H2,26,28,29) |
| InChIKey | PGWSUHAKIGZBKB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|