C21H35N5O3S — CID 111322994
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine (PubChem CID 111322994) has the molecular formula C21H35N5O3S and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111322994 |
| Molecular Formula | C21H35N5O3S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCC1)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C21H35N5O3S/c1-3-22-21(23-11-15-26-14-8-16-30(26,27)28)24-17-19(25-12-6-7-13-25)18-9-4-5-10-20(18)29-2/h4-5,9-10,19H,3,6-8,11-17H2,1-2H3,(H2,22,23,24) |
| InChIKey | DOIBJUOVNFHLAA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|