C21H35IN4O3S — CID 111142324
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111142324) has the molecular formula C21H35IN4O3S and a molecular weight of 550.51 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111142324 |
| Molecular Formula | C21H35IN4O3S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCCC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C21H34N4O3S.HI/c1-3-22-21(24-17-11-14-29(26,27)16-17)23-15-19(25-12-7-4-8-13-25)18-9-5-6-10-20(18)28-2;/h5-6,9-10,17,19H,3-4,7-8,11-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | MNYYJGNKQOHFMV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|