C15H23ClIN3O3S — CID 111755216
2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111755216) has the molecular formula C15H23ClIN3O3S and a molecular weight of 487.79 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111755216 |
| Molecular Formula | C15H23ClIN3O3S |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H22ClN3O3S.HI/c1-2-17-15(19-11-7-8-23(21,22)10-11)18-9-14(20)12-5-3-4-6-13(12)16;/h3-6,11,14,20H,2,7-10H2,1H3,(H2,17,18,19);1H |
| InChIKey | METSUWGJNZDRNN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|