C22H35ClN4O3 — CID 111993307
tert-butyl N-[4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate (PubChem CID 111993307) has the molecular formula C22H35ClN4O3 and a molecular weight of 439.00 g/mol. Its IUPAC name is tert-butyl N-[4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 111993307 |
| Molecular Formula | C22H35ClN4O3 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | tert-butyl N-[4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H35ClN4O3/c1-5-24-20(25-14-19(28)17-8-6-7-9-18(17)23)26-15-10-12-16(13-11-15)27-21(29)30-22(2,3)4/h6-9,15-16,19,28H,5,10-14H2,1-4H3,(H,27,29)(H2,24,25,26) |
| InChIKey | SQXRHSHRUKFDNV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|