C19H31ClN4O3 — CID 111999225
tert-butyl N-[3-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111999225) has the molecular formula C19H31ClN4O3 and a molecular weight of 398.94 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111999225 |
| Molecular Formula | C19H31ClN4O3 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | tert-butyl N-[3-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31ClN4O3/c1-5-21-17(22-11-8-12-23-18(26)27-19(2,3)4)24-13-16(25)14-9-6-7-10-15(14)20/h6-7,9-10,16,25H,5,8,11-13H2,1-4H3,(H,23,26)(H2,21,22,24) |
| InChIKey | BJCDLOBJOLGKQK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|