C18H29FN4O3 — CID 111999099
tert-butyl N-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111999099) has the molecular formula C18H29FN4O3 and a molecular weight of 368.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111999099 |
| Molecular Formula | C18H29FN4O3 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29FN4O3/c1-5-20-16(21-10-11-22-17(25)26-18(2,3)4)23-12-15(24)13-8-6-7-9-14(13)19/h6-9,15,24H,5,10-12H2,1-4H3,(H,22,25)(H2,20,21,23) |
| InChIKey | USPWQZCEAGFLIL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|