C19H34IN5O2 — CID 111884320
tert-butyl N-[2-[[N'-(3-anilinopropyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111884320) has the molecular formula C19H34IN5O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-(3-anilinopropyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-(3-anilinopropyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111884320 |
| Molecular Formula | C19H34IN5O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | tert-butyl N-[2-[[N'-(3-anilinopropyl)-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNc1ccccc1)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H33N5O2.HI/c1-5-20-17(23-14-15-24-18(25)26-19(2,3)4)22-13-9-12-21-16-10-7-6-8-11-16;/h6-8,10-11,21H,5,9,12-15H2,1-4H3,(H,24,25)(H2,20,22,23);1H |
| InChIKey | VBOQKJNDQYCLAS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|