C19H33IN4O3 — CID 109418313
tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 109418313) has the molecular formula C19H33IN4O3 and a molecular weight of 492.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109418313 |
| Molecular Formula | C19H33IN4O3 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H32N4O3.HI/c1-6-20-16(21-12-13-22-17(24)26-18(2,3)4)23-14-19(5,25)15-10-8-7-9-11-15;/h7-11,25H,6,12-14H2,1-5H3,(H,22,24)(H2,20,21,23);1H |
| InChIKey | OEDCFDJJYPTSLX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|