C18H33IN4O4 — CID 111672701
tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111672701) has the molecular formula C18H33IN4O4 and a molecular weight of 496.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111672701 |
| Molecular Formula | C18H33IN4O4 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C18H32N4O4.HI/c1-6-19-15(22-13-18(5,24)14-9-7-12-25-14)20-10-8-11-21-16(23)26-17(2,3)4;/h7,9,12,24H,6,8,10-11,13H2,1-5H3,(H,21,23)(H2,19,20,22);1H |
| InChIKey | CXMTVMJVRFQBAN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|