C17H25IN4O4 — CID 111672329
N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111672329) has the molecular formula C17H25IN4O4 and a molecular weight of 476.32 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111672329 |
| Molecular Formula | C17H25IN4O4 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCNC(=O)c1ccco1.I |
| InChI | InChI=1S/C17H24N4O4.HI/c1-3-18-16(21-12-17(2,23)14-7-5-11-25-14)20-9-8-19-15(22)13-6-4-10-24-13;/h4-7,10-11,23H,3,8-9,12H2,1-2H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | XCDTTYWSEKDRHI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|