C16H27IN4O3 — CID 111671557
N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111671557) has the molecular formula C16H27IN4O3 and a molecular weight of 450.32 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111671557 |
| Molecular Formula | C16H27IN4O3 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C16H26N4O3.HI/c1-3-17-15(19-9-8-18-14(21)12-6-7-12)20-11-16(2,22)13-5-4-10-23-13;/h4-5,10,12,22H,3,6-9,11H2,1-2H3,(H,18,21)(H2,17,19,20);1H |
| InChIKey | DCVKHXQLJGBXLI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|