C14H26IN3O4S — CID 111672753
1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111672753) has the molecular formula C14H26IN3O4S and a molecular weight of 459.35 g/mol. Its IUPAC name is 1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672753 |
| Molecular Formula | C14H26IN3O4S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCS(=O)(=O)CC.I |
| InChI | InChI=1S/C14H25N3O4S.HI/c1-4-15-13(16-8-10-22(19,20)5-2)17-11-14(3,18)12-7-6-9-21-12;/h6-7,9,18H,4-5,8,10-11H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | ABWNFTZQYCEHJN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|