C20H30IN3O4S — CID 111671555
1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111671555) has the molecular formula C20H30IN3O4S and a molecular weight of 535.45 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111671555 |
| Molecular Formula | C20H30IN3O4S |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCS(=O)(=O)Cc1ccccc1.I |
| InChI | InChI=1S/C20H29N3O4S.HI/c1-3-21-19(23-16-20(2,24)18-11-7-13-27-18)22-12-8-14-28(25,26)15-17-9-5-4-6-10-17;/h4-7,9-11,13,24H,3,8,12,14-16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | DSJPVSPMDUIRSM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|