C20H28N4O3 — CID 111672794
N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]benzamide (PubChem CID 111672794) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]benzamide.
| Compound Name | N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111672794 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[3-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]propyl]benzamide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28N4O3/c1-3-21-19(24-15-20(2,26)17-11-7-14-27-17)23-13-8-12-22-18(25)16-9-5-4-6-10-16/h4-7,9-11,14,26H,3,8,12-13,15H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | HDZVMJIWEJSOSR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|