C20H28N4O4 — CID 111672726
N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide (PubChem CID 111672726) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 111672726 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCNC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H28N4O4/c1-4-21-19(24-14-20(2,26)17-9-6-12-28-17)23-11-10-22-18(25)15-7-5-8-16(13-15)27-3/h5-9,12-13,26H,4,10-11,14H2,1-3H3,(H,22,25)(H2,21,23,24) |
| InChIKey | CEMPLLGNUSRCNG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|