C15H27N3O4 — CID 111672364
1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[2-(2-methoxyethoxy)ethyl]guanidine (PubChem CID 111672364) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[2-(2-methoxyethoxy)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[2-(2-methoxyethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111672364 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[2-(2-methoxyethoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCOCCOC |
| InChI | InChI=1S/C15H27N3O4/c1-4-16-14(17-7-9-21-11-10-20-3)18-12-15(2,19)13-6-5-8-22-13/h5-6,8,19H,4,7,9-12H2,1-3H3,(H2,16,17,18) |
| InChIKey | OLNWSDYUYUKGNU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|