C17H32N4O3 — CID 111671766
1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine (PubChem CID 111671766) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111671766 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCN(C)CCOC |
| InChI | InChI=1S/C17H32N4O3/c1-5-18-16(19-9-7-10-21(3)11-13-23-4)20-14-17(2,22)15-8-6-12-24-15/h6,8,12,22H,5,7,9-11,13-14H2,1-4H3,(H2,18,19,20) |
| InChIKey | JJGJTQRYZGSLAR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|