C18H31N3O4 — CID 111671924
methyl 7-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]heptanoate (PubChem CID 111671924) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is methyl 7-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]heptanoate.
| Compound Name | methyl 7-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111671924 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | methyl 7-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxypropyl]carbamimidoyl]amino]heptanoate |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCCCCC(=O)OC |
| InChI | InChI=1S/C18H31N3O4/c1-4-19-17(20-12-8-6-5-7-11-16(22)24-3)21-14-18(2,23)15-10-9-13-25-15/h9-10,13,23H,4-8,11-12,14H2,1-3H3,(H2,19,20,21) |
| InChIKey | OBNBWYDIBJZPLK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|