C16H27N3O3S — CID 111655150
methyl 5-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]pentanoate (PubChem CID 111655150) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is methyl 5-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]pentanoate.
| Compound Name | methyl 5-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 111655150 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | methyl 5-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]pentanoate |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCCCCC(=O)OC |
| InChI | InChI=1S/C16H27N3O3S/c1-4-17-15(18-9-6-5-7-14(20)22-3)19-12-16(2,21)13-8-10-23-11-13/h8,10-11,21H,4-7,9,12H2,1-3H3,(H2,17,18,19) |
| InChIKey | OPTNDLIHJCQEPT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|