C16H30IN3O2S — CID 111654085
1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(5-methoxypentyl)guanidine;hydroiodide (PubChem CID 111654085) has the molecular formula C16H30IN3O2S and a molecular weight of 455.41 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(5-methoxypentyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(5-methoxypentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654085 |
| Molecular Formula | C16H30IN3O2S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(5-methoxypentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCCCCCOC.I |
| InChI | InChI=1S/C16H29N3O2S.HI/c1-4-17-15(18-9-6-5-7-10-21-3)19-13-16(2,20)14-8-11-22-12-14;/h8,11-12,20H,4-7,9-10,13H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | XJIWSCPKZOJROJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|