C19H30IN5OS — CID 111654205
1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 111654205) has the molecular formula C19H30IN5OS and a molecular weight of 503.45 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654205 |
| Molecular Formula | C19H30IN5OS |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCCCCNc1ccccn1.I |
| InChI | InChI=1S/C19H29N5OS.HI/c1-3-20-18(24-15-19(2,25)16-9-13-26-14-16)23-12-7-6-11-22-17-8-4-5-10-21-17;/h4-5,8-10,13-14,25H,3,6-7,11-12,15H2,1-2H3,(H,21,22)(H2,20,23,24);1H |
| InChIKey | WGDBXIFWUOTDOX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|