C16H26IN5OS — CID 111655221
1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111655221) has the molecular formula C16H26IN5OS and a molecular weight of 463.39 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111655221 |
| Molecular Formula | C16H26IN5OS |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCCCn1cccn1.I |
| InChI | InChI=1S/C16H25N5OS.HI/c1-3-17-15(18-7-4-9-21-10-5-8-20-21)19-13-16(2,22)14-6-11-23-12-14;/h5-6,8,10-12,22H,3-4,7,9,13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | GWNHOFKSRHRIIH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|