C19H29N5S — CID 111703538
1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111703538) has the molecular formula C19H29N5S and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111703538 |
| Molecular Formula | C19H29N5S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C19H29N5S/c1-3-20-19(24-14-16(2)17-9-13-25-15-17)23-12-7-6-11-22-18-8-4-5-10-21-18/h4-5,8-10,13,15-16H,3,6-7,11-12,14H2,1-2H3,(H,21,22)(H2,20,23,24) |
| InChIKey | VBPFHNRBUHXTDF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|