C19H36N4S — CID 111704643
1-[7-(dimethylamino)heptyl]-3-ethyl-2-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111704643) has the molecular formula C19H36N4S and a molecular weight of 352.59 g/mol. Its IUPAC name is 1-[7-(dimethylamino)heptyl]-3-ethyl-2-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-[7-(dimethylamino)heptyl]-3-ethyl-2-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111704643 |
| Molecular Formula | C19H36N4S |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 1-[7-(dimethylamino)heptyl]-3-ethyl-2-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCCCCCCN(C)C |
| InChI | InChI=1S/C19H36N4S/c1-5-20-19(22-15-17(2)18-11-14-24-16-18)21-12-9-7-6-8-10-13-23(3)4/h11,14,16-17H,5-10,12-13,15H2,1-4H3,(H2,20,21,22) |
| InChIKey | DDBDQIKRBSDLHR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|