C16H27N3O2S — CID 111704086
propan-2-yl 3-[[N-ethyl-N'-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]propanoate (PubChem CID 111704086) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is propan-2-yl 3-[[N-ethyl-N'-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[N-ethyl-N'-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111704086 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | propan-2-yl 3-[[N-ethyl-N'-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]propanoate |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCC(=O)OC(C)C |
| InChI | InChI=1S/C16H27N3O2S/c1-5-17-16(18-8-6-15(20)21-12(2)3)19-10-13(4)14-7-9-22-11-14/h7,9,11-13H,5-6,8,10H2,1-4H3,(H2,17,18,19) |
| InChIKey | NXISZTLIJVYCCD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|