C17H28IN5S — CID 111704387
1-ethyl-3-[3-(4-methylpyrazol-1-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111704387) has the molecular formula C17H28IN5S and a molecular weight of 461.42 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-methylpyrazol-1-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-methylpyrazol-1-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111704387 |
| Molecular Formula | C17H28IN5S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 1-ethyl-3-[3-(4-methylpyrazol-1-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCCn1cc(C)cn1.I |
| InChI | InChI=1S/C17H27N5S.HI/c1-4-18-17(20-11-15(3)16-6-9-23-13-16)19-7-5-8-22-12-14(2)10-21-22;/h6,9-10,12-13,15H,4-5,7-8,11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | IOOBJBRFPIGMMN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|