C20H35IN6S2 — CID 111704339
1-ethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111704339) has the molecular formula C20H35IN6S2 and a molecular weight of 550.58 g/mol. Its IUPAC name is 1-ethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111704339 |
| Molecular Formula | C20H35IN6S2 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 1-ethyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCCc1nnc(SC)n1CC(C)C.I |
| InChI | InChI=1S/C20H34N6S2.HI/c1-6-21-19(23-12-16(4)17-9-11-28-14-17)22-10-7-8-18-24-25-20(27-5)26(18)13-15(2)3;/h9,11,14-16H,6-8,10,12-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | PGDGXSUPWZDXDY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|