C19H33N7S2 — CID 111534968
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 111534968) has the molecular formula C19H33N7S2 and a molecular weight of 423.66 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 111534968 |
| Molecular Formula | C19H33N7S2 |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCCCc1nnc(SC)n1CC(C)C |
| InChI | InChI=1S/C19H33N7S2/c1-6-15-11-22-17(28-15)12-23-18(20-7-2)21-10-8-9-16-24-25-19(27-5)26(16)13-14(3)4/h11,14H,6-10,12-13H2,1-5H3,(H2,20,21,23) |
| InChIKey | ARFFBOKNPNUYKQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|