C21H37IN6O2S — CID 111664138
1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide (PubChem CID 111664138) has the molecular formula C21H37IN6O2S and a molecular weight of 564.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111664138 |
| Molecular Formula | C21H37IN6O2S |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCCc1nnc(SC)n1CC(C)C.I |
| InChI | InChI=1S/C21H36N6O2S.HI/c1-7-22-19(24-14-21(5,28)17-11-10-16(4)29-17)23-12-8-9-18-25-26-20(30-6)27(18)13-15(2)3;/h10-11,15,28H,7-9,12-14H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | LNGVNOORXPPXOF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|