C20H34N6OS2 — CID 109418744
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 109418744) has the molecular formula C20H34N6OS2 and a molecular weight of 438.67 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 109418744 |
| Molecular Formula | C20H34N6OS2 |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCc1nnc(SC)n1CC(C)C |
| InChI | InChI=1S/C20H34N6OS2/c1-6-21-18(23-14-20(4,27)16-9-8-12-29-16)22-11-7-10-17-24-25-19(28-5)26(17)13-15(2)3/h8-9,12,15,27H,6-7,10-11,13-14H2,1-5H3,(H2,21,22,23) |
| InChIKey | FPWGVMAHCGKNGF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|