C22H36N6S2 — CID 111582400
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)guanidine (PubChem CID 111582400) has the molecular formula C22H36N6S2 and a molecular weight of 448.71 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111582400 |
| Molecular Formula | C22H36N6S2 |
| Molecular Weight | 448.71 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)c1cccs1)NCCCc1nnc(SC)n1C1CCCC1 |
| InChI | InChI=1S/C22H36N6S2/c1-5-23-20(25-16-22(2,3)18-12-9-15-30-18)24-14-8-13-19-26-27-21(29-4)28(19)17-10-6-7-11-17/h9,12,15,17H,5-8,10-11,13-14,16H2,1-4H3,(H2,23,24,25) |
| InChIKey | ZSRMJOPWIGYGKN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|