C23H36N6S — CID 111938561
1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine (PubChem CID 111938561) has the molecular formula C23H36N6S and a molecular weight of 428.65 g/mol. Its IUPAC name is 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111938561 |
| Molecular Formula | C23H36N6S |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1C)NCCCc1nnc(SC)n1C1CCCC1 |
| InChI | InChI=1S/C23H36N6S/c1-5-24-22(26-16-19-13-12-17(2)15-18(19)3)25-14-8-11-21-27-28-23(30-4)29(21)20-9-6-7-10-20/h12-13,15,20H,5-11,14,16H2,1-4H3,(H2,24,25,26) |
| InChIKey | DODZMXPZQVYANU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|