C21H35N7S2 — CID 111532313
2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine (PubChem CID 111532313) has the molecular formula C21H35N7S2 and a molecular weight of 449.69 g/mol. Its IUPAC name is 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine.
| Compound Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111532313 |
| Molecular Formula | C21H35N7S2 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1C1CCCC1)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C21H35N7S2/c1-4-17-15-25-19(30-17)12-14-24-20(22-5-2)23-13-8-11-18-26-27-21(29-3)28(18)16-9-6-7-10-16/h15-16H,4-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | PZQOFXGNCMHGFW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|