C22H35IN6S — CID 110949081
2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide (PubChem CID 110949081) has the molecular formula C22H35IN6S and a molecular weight of 542.54 g/mol. Its IUPAC name is 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110949081 |
| Molecular Formula | C22H35IN6S |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1C1CCCC1)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C22H34N6S.HI/c1-4-23-21(25-17(2)18-11-6-5-7-12-18)24-16-10-15-20-26-27-22(29-3)28(20)19-13-8-9-14-19;/h5-7,11-12,17,19H,4,8-10,13-16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | NJOBWHZZCZNMLL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|