C19H36N6S — CID 111160054
1-butyl-2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methylguanidine (PubChem CID 111160054) has the molecular formula C19H36N6S and a molecular weight of 380.61 g/mol. Its IUPAC name is 1-butyl-2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methylguanidine.
| Compound Name | 1-butyl-2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111160054 |
| Molecular Formula | C19H36N6S |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 1-butyl-2-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-ethyl-1-methylguanidine |
| SMILES | CCCCN(C)/C(=N/CCCc1nnc(SC)n1C1CCCC1)NCC |
| InChI | InChI=1S/C19H36N6S/c1-5-7-15-24(3)18(20-6-2)21-14-10-13-17-22-23-19(26-4)25(17)16-11-8-9-12-16/h16H,5-15H2,1-4H3,(H,20,21) |
| InChIKey | OXTVQYDPSHKCMJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|