C22H39N7OS — CID 111726907
N'-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111726907) has the molecular formula C22H39N7OS and a molecular weight of 449.67 g/mol. Its IUPAC name is N'-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726907 |
| Molecular Formula | C22H39N7OS |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | N'-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1C1CCCC1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C22H39N7OS/c1-3-23-21(28-12-10-19(17-28)27-13-15-30-16-14-27)24-11-6-9-20-25-26-22(31-2)29(20)18-7-4-5-8-18/h18-19H,3-17H2,1-2H3,(H,23,24) |
| InChIKey | SAPYAVBBHIMPSF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|