C20H39N5O — CID 111726891
N-ethyl-N'-(2-methyl-2-piperidin-1-ylpropyl)-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111726891) has the molecular formula C20H39N5O and a molecular weight of 365.57 g/mol. Its IUPAC name is N-ethyl-N'-(2-methyl-2-piperidin-1-ylpropyl)-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-methyl-2-piperidin-1-ylpropyl)-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726891 |
| Molecular Formula | C20H39N5O |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.32 |
| IUPAC Name | N-ethyl-N'-(2-methyl-2-piperidin-1-ylpropyl)-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCCCC1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C20H39N5O/c1-4-21-19(22-17-20(2,3)25-9-6-5-7-10-25)24-11-8-18(16-24)23-12-14-26-15-13-23/h18H,4-17H2,1-3H3,(H,21,22) |
| InChIKey | PJXHDUWNKKJKDP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|