C18H34N4O — CID 119143124
N-ethyl-N'-(oxan-2-ylmethyl)-3-piperidin-1-ylpyrrolidine-1-carboximidamide (PubChem CID 119143124) has the molecular formula C18H34N4O and a molecular weight of 322.50 g/mol. Its IUPAC name is N-ethyl-N'-(oxan-2-ylmethyl)-3-piperidin-1-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(oxan-2-ylmethyl)-3-piperidin-1-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119143124 |
| Molecular Formula | C18H34N4O |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | N-ethyl-N'-(oxan-2-ylmethyl)-3-piperidin-1-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCCCO1)N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C18H34N4O/c1-2-19-18(20-14-17-8-4-7-13-23-17)22-12-9-16(15-22)21-10-5-3-6-11-21/h16-17H,2-15H2,1H3,(H,19,20) |
| InChIKey | MDHFXSOEJMAFSS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|