C22H33F3N4O — CID 111725963
N-ethyl-N'-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111725963) has the molecular formula C22H33F3N4O and a molecular weight of 426.53 g/mol. Its IUPAC name is N-ethyl-N'-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111725963 |
| Molecular Formula | C22H33F3N4O |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | N-ethyl-N'-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(C(F)(F)F)c1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C22H33F3N4O/c1-4-26-20(29-9-8-19(15-29)28-10-12-30-13-11-28)27-16-21(2,3)17-6-5-7-18(14-17)22(23,24)25/h5-7,14,19H,4,8-13,15-16H2,1-3H3,(H,26,27) |
| InChIKey | CFZSVMCQCXZIGI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|