C19H26FN5O — CID 111993301
N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111993301) has the molecular formula C19H26FN5O and a molecular weight of 359.45 g/mol. Its IUPAC name is N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111993301 |
| Molecular Formula | C19H26FN5O |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C19H26FN5O/c1-2-22-19(23-13-16-11-15(12-21)3-4-18(16)20)25-6-5-17(14-25)24-7-9-26-10-8-24/h3-4,11,17H,2,5-10,13-14H2,1H3,(H,22,23) |
| InChIKey | LNPNXADKLIFEFU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|