C15H20FIN4 — CID 111493053
N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111493053) has the molecular formula C15H20FIN4 and a molecular weight of 402.26 g/mol. Its IUPAC name is N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111493053 |
| Molecular Formula | C15H20FIN4 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N1CCCC1.I |
| InChI | InChI=1S/C15H19FN4.HI/c1-2-18-15(20-7-3-4-8-20)19-11-13-9-12(10-17)5-6-14(13)16;/h5-6,9H,2-4,7-8,11H2,1H3,(H,18,19);1H |
| InChIKey | UUQBONJIPYCYMK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|