C21H23FN4 — CID 111992867
N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 111992867) has the molecular formula C21H23FN4 and a molecular weight of 350.44 g/mol. Its IUPAC name is N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111992867 |
| Molecular Formula | C21H23FN4 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H23FN4/c1-2-24-21(25-14-19-12-16(13-23)8-9-20(19)22)26-11-10-18(15-26)17-6-4-3-5-7-17/h3-9,12,18H,2,10-11,14-15H2,1H3,(H,24,25) |
| InChIKey | RSSUAORIYPGHIE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|