C17H24FIN4O — CID 111996224
N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111996224) has the molecular formula C17H24FIN4O and a molecular weight of 446.31 g/mol. Its IUPAC name is N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111996224 |
| Molecular Formula | C17H24FIN4O |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N1CCC(COC)C1.I |
| InChI | InChI=1S/C17H23FN4O.HI/c1-3-20-17(22-7-6-14(11-22)12-23-2)21-10-15-8-13(9-19)4-5-16(15)18;/h4-5,8,14H,3,6-7,10-12H2,1-2H3,(H,20,21);1H |
| InChIKey | ZFIMGZWHIHOQMK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|