C18H24FN5O2 — CID 111993763
methyl 4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111993763) has the molecular formula C18H24FN5O2 and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl 4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111993763 |
| Molecular Formula | C18H24FN5O2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | methyl 4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NC1CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C18H24FN5O2/c1-3-21-17(22-12-14-10-13(11-20)4-5-16(14)19)23-15-6-8-24(9-7-15)18(25)26-2/h4-5,10,15H,3,6-9,12H2,1-2H3,(H2,21,22,23) |
| InChIKey | RYVNWPGNHSTYLX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|