C22H33FIN5O2 — CID 111994440
tert-butyl N-[4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide (PubChem CID 111994440) has the molecular formula C22H33FIN5O2 and a molecular weight of 545.44 g/mol. Its IUPAC name is tert-butyl N-[4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111994440 |
| Molecular Formula | C22H33FIN5O2 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | tert-butyl N-[4-[[N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NC1CCC(NC(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C22H32FN5O2.HI/c1-5-25-20(26-14-16-12-15(13-24)6-11-19(16)23)27-17-7-9-18(10-8-17)28-21(29)30-22(2,3)4;/h6,11-12,17-18H,5,7-10,14H2,1-4H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | FHLUPVIVOYVWNR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|