C17H23FN4 — CID 111758832
2-[(4-cyano-2-fluorophenyl)methyl]-1-cyclohexyl-3-ethylguanidine (PubChem CID 111758832) has the molecular formula C17H23FN4 and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[(4-cyano-2-fluorophenyl)methyl]-1-cyclohexyl-3-ethylguanidine.
| Compound Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-cyclohexyl-3-ethylguanidine |
|---|---|
| PubChem CID | 111758832 |
| Molecular Formula | C17H23FN4 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-cyclohexyl-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(C#N)cc1F)NC1CCCCC1 |
| InChI | InChI=1S/C17H23FN4/c1-2-20-17(22-15-6-4-3-5-7-15)21-12-14-9-8-13(11-19)10-16(14)18/h8-10,15H,2-7,12H2,1H3,(H2,20,21,22) |
| InChIKey | WVDQYTQICCFCGM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|