C16H24FIN4 — CID 111760692
2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-pentylguanidine;hydroiodide (PubChem CID 111760692) has the molecular formula C16H24FIN4 and a molecular weight of 418.30 g/mol. Its IUPAC name is 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-pentylguanidine;hydroiodide.
| Compound Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-pentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111760692 |
| Molecular Formula | C16H24FIN4 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-ethyl-3-pentylguanidine;hydroiodide |
| SMILES | CCCCCN/C(=N/Cc1ccc(C#N)cc1F)NCC.I |
| InChI | InChI=1S/C16H23FN4.HI/c1-3-5-6-9-20-16(19-4-2)21-12-14-8-7-13(11-18)10-15(14)17;/h7-8,10H,3-6,9,12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | JUGZYNLWBFENIQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|